C22H27N3O — CID 158136961
4-[3-(4-benzylpiperidin-1-yl)-3-oxopropyl]benzenecarboximidamide (PubChem CID 158136961) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-[3-(4-benzylpiperidin-1-yl)-3-oxopropyl]benzenecarboximidamide.
| Compound Name | 4-[3-(4-benzylpiperidin-1-yl)-3-oxopropyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 158136961 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 4-[3-(4-benzylpiperidin-1-yl)-3-oxopropyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O/c23-22(24)20-9-6-17(7-10-20)8-11-21(26)25-14-12-19(13-15-25)16-18-4-2-1-3-5-18/h1-7,9-10,19H,8,11-16H2,(H3,23,24) |
| InChIKey | FTLOFIRLASRKDI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|