C40H58N4O5S — CID 58543247
(2R)-2-(benzylsulfonylmethyl)-4-(1-butanoylpiperidin-4-yl)-N-[(3S)-6-(4-carbamimidoylphenyl)-1-cyclohexyl-4-oxohexan-3-yl]butanamide (PubChem CID 58543247) has the molecular formula C40H58N4O5S and a molecular weight of 706.99 g/mol. Its IUPAC name is (2R)-2-(benzylsulfonylmethyl)-4-(1-butanoylpiperidin-4-yl)-N-[(3S)-6-(4-carbamimidoylphenyl)-1-cyclohexyl-4-oxohexan-3-yl]butanamide.
| Compound Name | (2R)-2-(benzylsulfonylmethyl)-4-(1-butanoylpiperidin-4-yl)-N-[(3S)-6-(4-carbamimidoylphenyl)-1-cyclohexyl-4-oxohexan-3-yl]butanamide |
|---|---|
| PubChem CID | 58543247 |
| Molecular Formula | C40H58N4O5S |
| Molecular Weight | 706.99 g/mol |
| Exact Mass | 706.41 |
| IUPAC Name | (2R)-2-(benzylsulfonylmethyl)-4-(1-butanoylpiperidin-4-yl)-N-[(3S)-6-(4-carbamimidoylphenyl)-1-cyclohexyl-4-oxohexan-3-yl]butanamide |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)[C@H](CCC2CCCCC2)NC(=O)[C@@H](CCC2CCN(C(=O)CCC)CC2)CS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C40H58N4O5S/c1-2-9-38(46)44-26-24-32(25-27-44)16-21-35(29-50(48,49)28-33-12-7-4-8-13-33)40(47)43-36(22-17-30-10-5-3-6-11-30)37(45)23-18-31-14-19-34(20-15-31)39(41)42/h4,7-8,12-15,19-20,30,32,35-36H,2-3,5-6,9-11,16-18,21-29H2,1H3,(H3,41,42)(H,43,47)/t35-,36-/m0/s1 |
| InChIKey | UKUVOYPGKIMIPA-ZPGRZCPFSA-N |
| XLogP | 6.37 |
| TPSA | 150.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.99 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|