C39H56N4O6S — CID 58543248
methyl 4-[(4R)-4-(benzylsulfonylmethyl)-5-[[(3S)-6-(4-carbamimidoylphenyl)-1-cyclohexyl-4-oxohexan-3-yl]amino]-5-oxopentyl]piperidine-1-carboxylate (PubChem CID 58543248) has the molecular formula C39H56N4O6S and a molecular weight of 708.97 g/mol. Its IUPAC name is methyl 4-[(4R)-4-(benzylsulfonylmethyl)-5-[[(3S)-6-(4-carbamimidoylphenyl)-1-cyclohexyl-4-oxohexan-3-yl]amino]-5-oxopentyl]piperidine-1-carboxylate.
| Compound Name | methyl 4-[(4R)-4-(benzylsulfonylmethyl)-5-[[(3S)-6-(4-carbamimidoylphenyl)-1-cyclohexyl-4-oxohexan-3-yl]amino]-5-oxopentyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58543248 |
| Molecular Formula | C39H56N4O6S |
| Molecular Weight | 708.97 g/mol |
| Exact Mass | 708.39 |
| IUPAC Name | methyl 4-[(4R)-4-(benzylsulfonylmethyl)-5-[[(3S)-6-(4-carbamimidoylphenyl)-1-cyclohexyl-4-oxohexan-3-yl]amino]-5-oxopentyl]piperidine-1-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)[C@H](CCC2CCCCC2)NC(=O)[C@@H](CCCC2CCN(C(=O)OC)CC2)CS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C39H56N4O6S/c1-49-39(46)43-25-23-30(24-26-43)13-8-14-34(28-50(47,48)27-32-11-6-3-7-12-32)38(45)42-35(21-17-29-9-4-2-5-10-29)36(44)22-18-31-15-19-33(20-16-31)37(40)41/h3,6-7,11-12,15-16,19-20,29-30,34-35H,2,4-5,8-10,13-14,17-18,21-28H2,1H3,(H3,40,41)(H,42,45)/t34-,35-/m0/s1 |
| InChIKey | IACVAUYMDZWJGB-PXLJZGITSA-N |
| XLogP | 6.20 |
| TPSA | 159.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.97 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|