C33H39N3O7S — CID 162092536
(4S)-7-[4-(1-aminoethenyl)phenyl]-4-[[(2R)-2-[(4-aminophenyl)methylsulfonylmethyl]-4-(4-hydroxyphenyl)butanoyl]amino]-5-oxoheptanoic acid (PubChem CID 162092536) has the molecular formula C33H39N3O7S and a molecular weight of 621.76 g/mol. Its IUPAC name is (4S)-7-[4-(1-aminoethenyl)phenyl]-4-[[(2R)-2-[(4-aminophenyl)methylsulfonylmethyl]-4-(4-hydroxyphenyl)butanoyl]amino]-5-oxoheptanoic acid.
| Compound Name | (4S)-7-[4-(1-aminoethenyl)phenyl]-4-[[(2R)-2-[(4-aminophenyl)methylsulfonylmethyl]-4-(4-hydroxyphenyl)butanoyl]amino]-5-oxoheptanoic acid |
|---|---|
| PubChem CID | 162092536 |
| Molecular Formula | C33H39N3O7S |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | (4S)-7-[4-(1-aminoethenyl)phenyl]-4-[[(2R)-2-[(4-aminophenyl)methylsulfonylmethyl]-4-(4-hydroxyphenyl)butanoyl]amino]-5-oxoheptanoic acid |
| SMILES | C=C(N)c1ccc(CCC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCc2ccc(O)cc2)CS(=O)(=O)Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C33H39N3O7S/c1-22(34)26-10-2-23(3-11-26)9-18-31(38)30(17-19-32(39)40)36-33(41)27(12-4-24-7-15-29(37)16-8-24)21-44(42,43)20-25-5-13-28(35)14-6-25/h2-3,5-8,10-11,13-16,27,30,37H,1,4,9,12,17-21,34-35H2,(H,36,41)(H,39,40)/t27-,30-/m0/s1 |
| InChIKey | GCPRNZYVRQNPAC-FIBWVYCGSA-N |
| XLogP | 3.62 |
| TPSA | 189.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|