C27H31N3O4S — CID 157410038
N-[4-(4-aminophenyl)-2-oxobutyl]-2-(benzylsulfonylmethyl)-4-pyridin-4-ylbutanamide (PubChem CID 157410038) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-[4-(4-aminophenyl)-2-oxobutyl]-2-(benzylsulfonylmethyl)-4-pyridin-4-ylbutanamide.
| Compound Name | N-[4-(4-aminophenyl)-2-oxobutyl]-2-(benzylsulfonylmethyl)-4-pyridin-4-ylbutanamide |
|---|---|
| PubChem CID | 157410038 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | N-[4-(4-aminophenyl)-2-oxobutyl]-2-(benzylsulfonylmethyl)-4-pyridin-4-ylbutanamide |
| SMILES | Nc1ccc(CCC(=O)CNC(=O)C(CCc2ccncc2)CS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H31N3O4S/c28-25-11-7-21(8-12-25)9-13-26(31)18-30-27(32)24(10-6-22-14-16-29-17-15-22)20-35(33,34)19-23-4-2-1-3-5-23/h1-5,7-8,11-12,14-17,24H,6,9-10,13,18-20,28H2,(H,30,32) |
| InChIKey | LQAQPZXVXIVZOT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|