C26H28N4O3S — CID 18382226
4-[3-oxo-3-[4-(4-phenylphenyl)sulfonylpiperazin-1-yl]propyl]benzenecarboximidamide (PubChem CID 18382226) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is 4-[3-oxo-3-[4-(4-phenylphenyl)sulfonylpiperazin-1-yl]propyl]benzenecarboximidamide.
| Compound Name | 4-[3-oxo-3-[4-(4-phenylphenyl)sulfonylpiperazin-1-yl]propyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 18382226 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 4-[3-oxo-3-[4-(4-phenylphenyl)sulfonylpiperazin-1-yl]propyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)N2CCN(S(=O)(=O)c3ccc(-c4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H28N4O3S/c27-26(28)23-9-6-20(7-10-23)8-15-25(31)29-16-18-30(19-17-29)34(32,33)24-13-11-22(12-14-24)21-4-2-1-3-5-21/h1-7,9-14H,8,15-19H2,(H3,27,28) |
| InChIKey | CIHHZJODRIUFPY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|