C15H20N4O3 — CID 22010102
4-[3-(4-carbamimidoylphenyl)propanoyl]piperazine-1-carboxylic acid (PubChem CID 22010102) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-[3-(4-carbamimidoylphenyl)propanoyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[3-(4-carbamimidoylphenyl)propanoyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 22010102 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 4-[3-(4-carbamimidoylphenyl)propanoyl]piperazine-1-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)N2CCN(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C15H20N4O3/c16-14(17)12-4-1-11(2-5-12)3-6-13(20)18-7-9-19(10-8-18)15(21)22/h1-2,4-5H,3,6-10H2,(H3,16,17)(H,21,22) |
| InChIKey | FOLWKCJQBSMECC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|