C21H26N4O5S — CID 162318159
acetic acid;4-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]benzenecarboximidamide (PubChem CID 162318159) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is acetic acid;4-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]benzenecarboximidamide.
| Compound Name | acetic acid;4-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 162318159 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | acetic acid;4-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]benzenecarboximidamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(CC(=O)N2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H22N4O3S.C2H4O2/c20-19(21)16-8-6-15(7-9-16)14-18(24)22-10-12-23(13-11-22)27(25,26)17-4-2-1-3-5-17;1-2(3)4/h1-9H,10-14H2,(H3,20,21);1H3,(H,3,4) |
| InChIKey | YIYKZZAIXOMVJM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|