C21H28N4O5S — CID 174413708
acetic acid;4-[[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methyl]benzenecarboximidamide (PubChem CID 174413708) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is acetic acid;4-[[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | acetic acid;4-[[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 174413708 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | acetic acid;4-[[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methyl]benzenecarboximidamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(CN2CCN(S(=O)(=O)c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H24N4O3S.C2H4O2/c1-26-17-6-8-18(9-7-17)27(24,25)23-12-10-22(11-13-23)14-15-2-4-16(5-3-15)19(20)21;1-2(3)4/h2-9H,10-14H2,1H3,(H3,20,21);1H3,(H,3,4) |
| InChIKey | OEYWEBOJBYAHLH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|