C25H31N5O4S — CID 70074881
4-[[2-hydroxy-3-[4-(6-methoxynaphthalen-2-yl)sulfonylpiperazin-1-yl]propyl]amino]benzenecarboximidamide (PubChem CID 70074881) has the molecular formula C25H31N5O4S and a molecular weight of 497.62 g/mol. Its IUPAC name is 4-[[2-hydroxy-3-[4-(6-methoxynaphthalen-2-yl)sulfonylpiperazin-1-yl]propyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[2-hydroxy-3-[4-(6-methoxynaphthalen-2-yl)sulfonylpiperazin-1-yl]propyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 70074881 |
| Molecular Formula | C25H31N5O4S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 4-[[2-hydroxy-3-[4-(6-methoxynaphthalen-2-yl)sulfonylpiperazin-1-yl]propyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCC(O)CN2CCN(S(=O)(=O)c3ccc4cc(OC)ccc4c3)CC2)cc1 |
| InChI | InChI=1S/C25H31N5O4S/c1-34-23-8-4-20-15-24(9-5-19(20)14-23)35(32,33)30-12-10-29(11-13-30)17-22(31)16-28-21-6-2-18(3-7-21)25(26)27/h2-9,14-15,22,28,31H,10-13,16-17H2,1H3,(H3,26,27) |
| InChIKey | OMTZTZPABFIQBA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|