C21H26F3N5O3S — CID 54237878
4-[[2-hydroxy-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propyl]amino]benzenecarboximidamide (PubChem CID 54237878) has the molecular formula C21H26F3N5O3S and a molecular weight of 485.53 g/mol. Its IUPAC name is 4-[[2-hydroxy-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[2-hydroxy-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 54237878 |
| Molecular Formula | C21H26F3N5O3S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 4-[[2-hydroxy-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCC(O)CN2CCN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H26F3N5O3S/c22-21(23,24)16-2-1-3-19(12-16)33(31,32)29-10-8-28(9-11-29)14-18(30)13-27-17-6-4-15(5-7-17)20(25)26/h1-7,12,18,27,30H,8-11,13-14H2,(H3,25,26) |
| InChIKey | QNWAHXVNLUWDGZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|