C22H27F3N2O4S — CID 55346498
1-(4-ethylphenoxy)-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-2-ol (PubChem CID 55346498) has the molecular formula C22H27F3N2O4S and a molecular weight of 472.53 g/mol. Its IUPAC name is 1-(4-ethylphenoxy)-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-2-ol.
| Compound Name | 1-(4-ethylphenoxy)-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 55346498 |
| Molecular Formula | C22H27F3N2O4S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 1-(4-ethylphenoxy)-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-2-ol |
| SMILES | CCc1ccc(OCC(O)CN2CCN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C22H27F3N2O4S/c1-2-17-6-8-20(9-7-17)31-16-19(28)15-26-10-12-27(13-11-26)32(29,30)21-5-3-4-18(14-21)22(23,24)25/h3-9,14,19,28H,2,10-13,15-16H2,1H3 |
| InChIKey | JWELEGAZKAIDQP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |