C20H22F3NO2 — CID 21396081
1-pyrrolidin-1-yl-3-[4-[3-(trifluoromethyl)phenyl]phenoxy]propan-2-ol (PubChem CID 21396081) has the molecular formula C20H22F3NO2 and a molecular weight of 365.40 g/mol. Its IUPAC name is 1-pyrrolidin-1-yl-3-[4-[3-(trifluoromethyl)phenyl]phenoxy]propan-2-ol.
| Compound Name | 1-pyrrolidin-1-yl-3-[4-[3-(trifluoromethyl)phenyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 21396081 |
| Molecular Formula | C20H22F3NO2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-pyrrolidin-1-yl-3-[4-[3-(trifluoromethyl)phenyl]phenoxy]propan-2-ol |
| SMILES | OC(COc1ccc(-c2cccc(C(F)(F)F)c2)cc1)CN1CCCC1 |
| InChI | InChI=1S/C20H22F3NO2/c21-20(22,23)17-5-3-4-16(12-17)15-6-8-19(9-7-15)26-14-18(25)13-24-10-1-2-11-24/h3-9,12,18,25H,1-2,10-11,13-14H2 |
| InChIKey | PTPVWSCMYZIZMW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |