C20H22ClF3N2O2 — CID 66549919
(2R)-1-[4-(3-chlorophenyl)piperazin-1-yl]-3-[4-(trifluoromethyl)phenoxy]propan-2-ol (PubChem CID 66549919) has the molecular formula C20H22ClF3N2O2 and a molecular weight of 414.86 g/mol. Its IUPAC name is (2R)-1-[4-(3-chlorophenyl)piperazin-1-yl]-3-[4-(trifluoromethyl)phenoxy]propan-2-ol.
| Compound Name | (2R)-1-[4-(3-chlorophenyl)piperazin-1-yl]-3-[4-(trifluoromethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 66549919 |
| Molecular Formula | C20H22ClF3N2O2 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (2R)-1-[4-(3-chlorophenyl)piperazin-1-yl]-3-[4-(trifluoromethyl)phenoxy]propan-2-ol |
| SMILES | O[C@@H](COc1ccc(C(F)(F)F)cc1)CN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H22ClF3N2O2/c21-16-2-1-3-17(12-16)26-10-8-25(9-11-26)13-18(27)14-28-19-6-4-15(5-7-19)20(22,23)24/h1-7,12,18,27H,8-11,13-14H2/t18-/m1/s1 |
| InChIKey | KIJFSENPMAELJN-GOSISDBHSA-N |
| XLogP | 3.92 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |