C24H30ClN3O3 — CID 54427992
1-[4-[3-[4-(3-chlorophenyl)piperazin-1-yl]-2-hydroxypropoxy]phenyl]-3-(dimethylamino)prop-2-en-1-one (PubChem CID 54427992) has the molecular formula C24H30ClN3O3 and a molecular weight of 443.98 g/mol. Its IUPAC name is 1-[4-[3-[4-(3-chlorophenyl)piperazin-1-yl]-2-hydroxypropoxy]phenyl]-3-(dimethylamino)prop-2-en-1-one.
| Compound Name | 1-[4-[3-[4-(3-chlorophenyl)piperazin-1-yl]-2-hydroxypropoxy]phenyl]-3-(dimethylamino)prop-2-en-1-one |
|---|---|
| PubChem CID | 54427992 |
| Molecular Formula | C24H30ClN3O3 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1-[4-[3-[4-(3-chlorophenyl)piperazin-1-yl]-2-hydroxypropoxy]phenyl]-3-(dimethylamino)prop-2-en-1-one |
| SMILES | CN(C)C=CC(=O)c1ccc(OCC(O)CN2CCN(c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C24H30ClN3O3/c1-26(2)11-10-24(30)19-6-8-23(9-7-19)31-18-22(29)17-27-12-14-28(15-13-27)21-5-3-4-20(25)16-21/h3-11,16,22,29H,12-15,17-18H2,1-2H3 |
| InChIKey | WFMDZUKYHDOPHH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|