C23H31ClN2O2 — CID 1325567
(2R)-1-[4-(3-chlorophenyl)piperazin-1-yl]-3-(3-methyl-4-propan-2-ylphenoxy)propan-2-ol (PubChem CID 1325567) has the molecular formula C23H31ClN2O2 and a molecular weight of 402.97 g/mol. Its IUPAC name is (2R)-1-[4-(3-chlorophenyl)piperazin-1-yl]-3-(3-methyl-4-propan-2-ylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-[4-(3-chlorophenyl)piperazin-1-yl]-3-(3-methyl-4-propan-2-ylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 1325567 |
| Molecular Formula | C23H31ClN2O2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (2R)-1-[4-(3-chlorophenyl)piperazin-1-yl]-3-(3-methyl-4-propan-2-ylphenoxy)propan-2-ol |
| SMILES | Cc1cc(OC[C@H](O)CN2CCN(c3cccc(Cl)c3)CC2)ccc1C(C)C |
| InChI | InChI=1S/C23H31ClN2O2/c1-17(2)23-8-7-22(13-18(23)3)28-16-21(27)15-25-9-11-26(12-10-25)20-6-4-5-19(24)14-20/h4-8,13-14,17,21,27H,9-12,15-16H2,1-3H3/t21-/m1/s1 |
| InChIKey | NEZIBQQKSDUWAM-OAQYLSRUSA-N |
| XLogP | 4.33 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |