C15H24N2O8S2 — CID 142762335
3-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-hydroxypropane-1-sulfonic acid (PubChem CID 142762335) has the molecular formula C15H24N2O8S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-hydroxypropane-1-sulfonic acid.
| Compound Name | 3-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-hydroxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 142762335 |
| Molecular Formula | C15H24N2O8S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 3-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-hydroxypropane-1-sulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(CC(O)CS(=O)(=O)O)CC2)cc1OC |
| InChI | InChI=1S/C15H24N2O8S2/c1-24-14-4-3-13(9-15(14)25-2)27(22,23)17-7-5-16(6-8-17)10-12(18)11-26(19,20)21/h3-4,9,12,18H,5-8,10-11H2,1-2H3,(H,19,20,21) |
| InChIKey | YDXBSDWABDLLON-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|