C17H28N2O6S2 — CID 56549188
1-(3,4-dimethoxyphenyl)sulfonyl-4-(3-methylbutylsulfonyl)piperazine (PubChem CID 56549188) has the molecular formula C17H28N2O6S2 and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-4-(3-methylbutylsulfonyl)piperazine.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-4-(3-methylbutylsulfonyl)piperazine |
|---|---|
| PubChem CID | 56549188 |
| Molecular Formula | C17H28N2O6S2 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-4-(3-methylbutylsulfonyl)piperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)CCC(C)C)CC2)cc1OC |
| InChI | InChI=1S/C17H28N2O6S2/c1-14(2)7-12-26(20,21)18-8-10-19(11-9-18)27(22,23)15-5-6-16(24-3)17(13-15)25-4/h5-6,13-14H,7-12H2,1-4H3 |
| InChIKey | QIUHGSLHCYEMLQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |