C18H20N4O3S — CID 10384655
3-[4-[5-(4-carbamimidoylphenyl)-1-oxo-1,2,5-thiadiazolidin-2-yl]phenyl]propanoic acid (PubChem CID 10384655) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is 3-[4-[5-(4-carbamimidoylphenyl)-1-oxo-1,2,5-thiadiazolidin-2-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[5-(4-carbamimidoylphenyl)-1-oxo-1,2,5-thiadiazolidin-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10384655 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 3-[4-[5-(4-carbamimidoylphenyl)-1-oxo-1,2,5-thiadiazolidin-2-yl]phenyl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(c3ccc(CCC(=O)O)cc3)S2=O)cc1 |
| InChI | InChI=1S/C18H20N4O3S/c19-18(20)14-4-8-16(9-5-14)22-12-11-21(26(22)25)15-6-1-13(2-7-15)3-10-17(23)24/h1-2,4-9H,3,10-12H2,(H3,19,20)(H,23,24) |
| InChIKey | JETZIYHCYXZHPT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|