C19H23ClN4O3 — CID 160953313
3-[4-[[(4-carbamimidoylphenyl)-methylcarbamoyl]-methylamino]phenyl]propanoic acid;hydrochloride (PubChem CID 160953313) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 3-[4-[[(4-carbamimidoylphenyl)-methylcarbamoyl]-methylamino]phenyl]propanoic acid;hydrochloride.
| Compound Name | 3-[4-[[(4-carbamimidoylphenyl)-methylcarbamoyl]-methylamino]phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 160953313 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 3-[4-[[(4-carbamimidoylphenyl)-methylcarbamoyl]-methylamino]phenyl]propanoic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N(C)C(=O)N(C)c2ccc(CCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H22N4O3.ClH/c1-22(15-8-3-13(4-9-15)5-12-17(24)25)19(26)23(2)16-10-6-14(7-11-16)18(20)21;/h3-4,6-11H,5,12H2,1-2H3,(H3,20,21)(H,24,25);1H |
| InChIKey | ZZAIWMOHSVBERA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|