C21H22N4O3 — CID 22098734
3-[4-[4-(4-carbamimidoylphenyl)-3,5-dimethyl-2-oxoimidazol-1-yl]phenyl]propanoic acid (PubChem CID 22098734) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-[4-[4-(4-carbamimidoylphenyl)-3,5-dimethyl-2-oxoimidazol-1-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[4-(4-carbamimidoylphenyl)-3,5-dimethyl-2-oxoimidazol-1-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22098734 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3-[4-[4-(4-carbamimidoylphenyl)-3,5-dimethyl-2-oxoimidazol-1-yl]phenyl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2c(C)n(-c3ccc(CCC(=O)O)cc3)c(=O)n2C)cc1 |
| InChI | InChI=1S/C21H22N4O3/c1-13-19(15-6-8-16(9-7-15)20(22)23)24(2)21(28)25(13)17-10-3-14(4-11-17)5-12-18(26)27/h3-4,6-11H,5,12H2,1-2H3,(H3,22,23)(H,26,27) |
| InChIKey | GUDPYXSPJWWYOC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|