C27H26ClN3O4 — CID 18991025
3-[4-[3-benzyl-1-(4-carbamimidoylphenyl)-2,4-dioxopyrrolidin-3-yl]phenyl]propanoic acid;hydrochloride (PubChem CID 18991025) has the molecular formula C27H26ClN3O4 and a molecular weight of 491.98 g/mol. Its IUPAC name is 3-[4-[3-benzyl-1-(4-carbamimidoylphenyl)-2,4-dioxopyrrolidin-3-yl]phenyl]propanoic acid;hydrochloride.
| Compound Name | 3-[4-[3-benzyl-1-(4-carbamimidoylphenyl)-2,4-dioxopyrrolidin-3-yl]phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 18991025 |
| Molecular Formula | C27H26ClN3O4 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 3-[4-[3-benzyl-1-(4-carbamimidoylphenyl)-2,4-dioxopyrrolidin-3-yl]phenyl]propanoic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N2CC(=O)C(Cc3ccccc3)(c3ccc(CCC(=O)O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H25N3O4.ClH/c28-25(29)20-9-13-22(14-10-20)30-17-23(31)27(26(30)34,16-19-4-2-1-3-5-19)21-11-6-18(7-12-21)8-15-24(32)33;/h1-7,9-14H,8,15-17H2,(H3,28,29)(H,32,33);1H |
| InChIKey | ROFCFLXRMKROHI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|