C26H32N2O3 — CID 95097651
3-phenyl-1-[(3S)-3-[[4-(pyrrolidine-1-carbonyl)phenoxy]methyl]piperidin-1-yl]propan-1-one (PubChem CID 95097651) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is 3-phenyl-1-[(3S)-3-[[4-(pyrrolidine-1-carbonyl)phenoxy]methyl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-phenyl-1-[(3S)-3-[[4-(pyrrolidine-1-carbonyl)phenoxy]methyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 95097651 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 3-phenyl-1-[(3S)-3-[[4-(pyrrolidine-1-carbonyl)phenoxy]methyl]piperidin-1-yl]propan-1-one |
| SMILES | O=C(CCc1ccccc1)N1CCC[C@H](COc2ccc(C(=O)N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C26H32N2O3/c29-25(15-10-21-7-2-1-3-8-21)28-18-6-9-22(19-28)20-31-24-13-11-23(12-14-24)26(30)27-16-4-5-17-27/h1-3,7-8,11-14,22H,4-6,9-10,15-20H2/t22-/m0/s1 |
| InChIKey | HTFBCWGAKLXTOZ-QFIPXVFZSA-N |
| XLogP | 4.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |