C26H31FN2O3 — CID 53150037
2-(2-fluorophenyl)-1-[3-[[4-(piperidine-1-carbonyl)phenoxy]methyl]piperidin-1-yl]ethanone (PubChem CID 53150037) has the molecular formula C26H31FN2O3 and a molecular weight of 438.54 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1-[3-[[4-(piperidine-1-carbonyl)phenoxy]methyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(2-fluorophenyl)-1-[3-[[4-(piperidine-1-carbonyl)phenoxy]methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 53150037 |
| Molecular Formula | C26H31FN2O3 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-(2-fluorophenyl)-1-[3-[[4-(piperidine-1-carbonyl)phenoxy]methyl]piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccccc1F)N1CCCC(COc2ccc(C(=O)N3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C26H31FN2O3/c27-24-9-3-2-8-22(24)17-25(30)29-16-6-7-20(18-29)19-32-23-12-10-21(11-13-23)26(31)28-14-4-1-5-15-28/h2-3,8-13,20H,1,4-7,14-19H2 |
| InChIKey | GQHRKSYXZJIHCS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |