C24H27FN2O4 — CID 95097733
[4-[[(3S)-1-(2-fluorobenzoyl)piperidin-3-yl]methoxy]phenyl]-morpholin-4-ylmethanone (PubChem CID 95097733) has the molecular formula C24H27FN2O4 and a molecular weight of 426.49 g/mol. Its IUPAC name is [4-[[(3S)-1-(2-fluorobenzoyl)piperidin-3-yl]methoxy]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[[(3S)-1-(2-fluorobenzoyl)piperidin-3-yl]methoxy]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 95097733 |
| Molecular Formula | C24H27FN2O4 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | [4-[[(3S)-1-(2-fluorobenzoyl)piperidin-3-yl]methoxy]phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(OC[C@H]2CCCN(C(=O)c3ccccc3F)C2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C24H27FN2O4/c25-22-6-2-1-5-21(22)24(29)27-11-3-4-18(16-27)17-31-20-9-7-19(8-10-20)23(28)26-12-14-30-15-13-26/h1-2,5-10,18H,3-4,11-17H2/t18-/m0/s1 |
| InChIKey | RYQMHVUKRBMXGD-SFHVURJKSA-N |
| XLogP | 3.23 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |