C24H27FN2O3 — CID 92901011
N-cyclopropyl-3-[[(3R)-1-[2-(2-fluorophenyl)acetyl]piperidin-3-yl]methoxy]benzamide (PubChem CID 92901011) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is N-cyclopropyl-3-[[(3R)-1-[2-(2-fluorophenyl)acetyl]piperidin-3-yl]methoxy]benzamide.
| Compound Name | N-cyclopropyl-3-[[(3R)-1-[2-(2-fluorophenyl)acetyl]piperidin-3-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 92901011 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-cyclopropyl-3-[[(3R)-1-[2-(2-fluorophenyl)acetyl]piperidin-3-yl]methoxy]benzamide |
| SMILES | O=C(NC1CC1)c1cccc(OC[C@@H]2CCCN(C(=O)Cc3ccccc3F)C2)c1 |
| InChI | InChI=1S/C24H27FN2O3/c25-22-9-2-1-6-18(22)14-23(28)27-12-4-5-17(15-27)16-30-21-8-3-7-19(13-21)24(29)26-20-10-11-20/h1-3,6-9,13,17,20H,4-5,10-12,14-16H2,(H,26,29)/t17-/m1/s1 |
| InChIKey | NTYZGRSVMVAYHI-QGZVFWFLSA-N |
| XLogP | 3.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |