C24H25F3N2O3 — CID 50847037
N-cyclopropyl-3-[[1-[4-(trifluoromethyl)benzoyl]piperidin-3-yl]methoxy]benzamide (PubChem CID 50847037) has the molecular formula C24H25F3N2O3 and a molecular weight of 446.47 g/mol. Its IUPAC name is N-cyclopropyl-3-[[1-[4-(trifluoromethyl)benzoyl]piperidin-3-yl]methoxy]benzamide.
| Compound Name | N-cyclopropyl-3-[[1-[4-(trifluoromethyl)benzoyl]piperidin-3-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 50847037 |
| Molecular Formula | C24H25F3N2O3 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-cyclopropyl-3-[[1-[4-(trifluoromethyl)benzoyl]piperidin-3-yl]methoxy]benzamide |
| SMILES | O=C(NC1CC1)c1cccc(OCC2CCCN(C(=O)c3ccc(C(F)(F)F)cc3)C2)c1 |
| InChI | InChI=1S/C24H25F3N2O3/c25-24(26,27)19-8-6-17(7-9-19)23(31)29-12-2-3-16(14-29)15-32-21-5-1-4-18(13-21)22(30)28-20-10-11-20/h1,4-9,13,16,20H,2-3,10-12,14-15H2,(H,28,30) |
| InChIKey | UHHRXERTKAKEPJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |