C21H24N2O4 — CID 50846714
N-cyclopropyl-3-[[1-(furan-3-carbonyl)piperidin-3-yl]methoxy]benzamide (PubChem CID 50846714) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N-cyclopropyl-3-[[1-(furan-3-carbonyl)piperidin-3-yl]methoxy]benzamide.
| Compound Name | N-cyclopropyl-3-[[1-(furan-3-carbonyl)piperidin-3-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 50846714 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-cyclopropyl-3-[[1-(furan-3-carbonyl)piperidin-3-yl]methoxy]benzamide |
| SMILES | O=C(NC1CC1)c1cccc(OCC2CCCN(C(=O)c3ccoc3)C2)c1 |
| InChI | InChI=1S/C21H24N2O4/c24-20(22-18-6-7-18)16-4-1-5-19(11-16)27-13-15-3-2-9-23(12-15)21(25)17-8-10-26-14-17/h1,4-5,8,10-11,14-15,18H,2-3,6-7,9,12-13H2,(H,22,24) |
| InChIKey | YSDDHMAIVALQBV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |