C25H30N2O3 — CID 50846747
N-cyclopropyl-3-[[1-[2-(4-methylphenyl)acetyl]piperidin-3-yl]methoxy]benzamide (PubChem CID 50846747) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-cyclopropyl-3-[[1-[2-(4-methylphenyl)acetyl]piperidin-3-yl]methoxy]benzamide.
| Compound Name | N-cyclopropyl-3-[[1-[2-(4-methylphenyl)acetyl]piperidin-3-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 50846747 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-cyclopropyl-3-[[1-[2-(4-methylphenyl)acetyl]piperidin-3-yl]methoxy]benzamide |
| SMILES | Cc1ccc(CC(=O)N2CCCC(COc3cccc(C(=O)NC4CC4)c3)C2)cc1 |
| InChI | InChI=1S/C25H30N2O3/c1-18-7-9-19(10-8-18)14-24(28)27-13-3-4-20(16-27)17-30-23-6-2-5-21(15-23)25(29)26-22-11-12-22/h2,5-10,15,20,22H,3-4,11-14,16-17H2,1H3,(H,26,29) |
| InChIKey | SORXQLAISWJTRR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |