C23H29N5O — CID 118674355
cyclopentyl-[4-[[5-(1H-pyrazol-4-yl)benzimidazol-1-yl]methyl]azepan-1-yl]methanone (PubChem CID 118674355) has the molecular formula C23H29N5O and a molecular weight of 391.52 g/mol. Its IUPAC name is cyclopentyl-[4-[[5-(1H-pyrazol-4-yl)benzimidazol-1-yl]methyl]azepan-1-yl]methanone.
| Compound Name | cyclopentyl-[4-[[5-(1H-pyrazol-4-yl)benzimidazol-1-yl]methyl]azepan-1-yl]methanone |
|---|---|
| PubChem CID | 118674355 |
| Molecular Formula | C23H29N5O |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | cyclopentyl-[4-[[5-(1H-pyrazol-4-yl)benzimidazol-1-yl]methyl]azepan-1-yl]methanone |
| SMILES | O=C(C1CCCC1)N1CCCC(Cn2cnc3cc(-c4cn[nH]c4)ccc32)CC1 |
| InChI | InChI=1S/C23H29N5O/c29-23(18-5-1-2-6-18)27-10-3-4-17(9-11-27)15-28-16-24-21-12-19(7-8-22(21)28)20-13-25-26-14-20/h7-8,12-14,16-18H,1-6,9-11,15H2,(H,25,26) |
| InChIKey | QQTTUUSLJIICPV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |