C20H25N3O — CID 169094718
cyclopentyl-[4-[4-(1H-pyrazol-4-yl)phenyl]piperidin-1-yl]methanone (PubChem CID 169094718) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is cyclopentyl-[4-[4-(1H-pyrazol-4-yl)phenyl]piperidin-1-yl]methanone.
| Compound Name | cyclopentyl-[4-[4-(1H-pyrazol-4-yl)phenyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 169094718 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | cyclopentyl-[4-[4-(1H-pyrazol-4-yl)phenyl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CCCC1)N1CCC(c2ccc(-c3cn[nH]c3)cc2)CC1 |
| InChI | InChI=1S/C20H25N3O/c24-20(18-3-1-2-4-18)23-11-9-17(10-12-23)15-5-7-16(8-6-15)19-13-21-22-14-19/h5-8,13-14,17-18H,1-4,9-12H2,(H,21,22) |
| InChIKey | FHCQJJIMAKLQCH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |