C24H31N5O — CID 130434277
cyclohexyl-[(4S)-4-[[5-(1H-pyrazol-4-yl)benzimidazol-1-yl]methyl]azepan-1-yl]methanone (PubChem CID 130434277) has the molecular formula C24H31N5O and a molecular weight of 405.55 g/mol. Its IUPAC name is cyclohexyl-[(4S)-4-[[5-(1H-pyrazol-4-yl)benzimidazol-1-yl]methyl]azepan-1-yl]methanone.
| Compound Name | cyclohexyl-[(4S)-4-[[5-(1H-pyrazol-4-yl)benzimidazol-1-yl]methyl]azepan-1-yl]methanone |
|---|---|
| PubChem CID | 130434277 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | cyclohexyl-[(4S)-4-[[5-(1H-pyrazol-4-yl)benzimidazol-1-yl]methyl]azepan-1-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1CCC[C@H](Cn2cnc3cc(-c4cn[nH]c4)ccc32)CC1 |
| InChI | InChI=1S/C24H31N5O/c30-24(19-6-2-1-3-7-19)28-11-4-5-18(10-12-28)16-29-17-25-22-13-20(8-9-23(22)29)21-14-26-27-15-21/h8-9,13-15,17-19H,1-7,10-12,16H2,(H,26,27)/t18-/m0/s1 |
| InChIKey | GLWPQONQSLKTFH-SFHVURJKSA-N |
| XLogP | 4.64 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |