C25H30N4O2 — CID 123635183
benzyl 4-[[5-(1,3-diiminopropan-2-yl)-2,3-dihydroindol-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 123635183) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is benzyl 4-[[5-(1,3-diiminopropan-2-yl)-2,3-dihydroindol-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[5-(1,3-diiminopropan-2-yl)-2,3-dihydroindol-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123635183 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | benzyl 4-[[5-(1,3-diiminopropan-2-yl)-2,3-dihydroindol-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | [H]/N=C/C(/C=N/[H])c1ccc2c(c1)CCN2CC1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H30N4O2/c26-15-23(16-27)21-6-7-24-22(14-21)10-13-29(24)17-19-8-11-28(12-9-19)25(30)31-18-20-4-2-1-3-5-20/h1-7,14-16,19,23,26-27H,8-13,17-18H2/b26-15+,27-16+ |
| InChIKey | SLAZQNGAPUMNGQ-JQMRRPHZSA-N |
| XLogP | 4.48 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|