C19H18ClN3OS2 — CID 91506597
1-[1-[(3-chloro-2H-thiopyran-6-yl)methyl]-2,3-dihydroindol-5-yl]-3-thiophen-3-ylurea (PubChem CID 91506597) has the molecular formula C19H18ClN3OS2 and a molecular weight of 403.96 g/mol. Its IUPAC name is 1-[1-[(3-chloro-2H-thiopyran-6-yl)methyl]-2,3-dihydroindol-5-yl]-3-thiophen-3-ylurea.
| Compound Name | 1-[1-[(3-chloro-2H-thiopyran-6-yl)methyl]-2,3-dihydroindol-5-yl]-3-thiophen-3-ylurea |
|---|---|
| PubChem CID | 91506597 |
| Molecular Formula | C19H18ClN3OS2 |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 1-[1-[(3-chloro-2H-thiopyran-6-yl)methyl]-2,3-dihydroindol-5-yl]-3-thiophen-3-ylurea |
| SMILES | O=C(Nc1ccsc1)Nc1ccc2c(c1)CCN2CC1=CC=C(Cl)CS1 |
| InChI | InChI=1S/C19H18ClN3OS2/c20-14-1-3-17(26-11-14)10-23-7-5-13-9-15(2-4-18(13)23)21-19(24)22-16-6-8-25-12-16/h1-4,6,8-9,12H,5,7,10-11H2,(H2,21,22,24) |
| InChIKey | QUSHNCAMEMXBTO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|