C17H15ClN2O2 — CID 10734075
1-benzyl-3-(4-chlorophenyl)-1,3-diazinane-2,4-dione (PubChem CID 10734075) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is 1-benzyl-3-(4-chlorophenyl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-benzyl-3-(4-chlorophenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 10734075 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-benzyl-3-(4-chlorophenyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(Cc2ccccc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2O2/c18-14-6-8-15(9-7-14)20-16(21)10-11-19(17(20)22)12-13-4-2-1-3-5-13/h1-9H,10-12H2 |
| InChIKey | ZMDUQXUILOGVER-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |