C20H23ClN2O2 — CID 24733010
4-benzyl-1-[2-(4-chlorophenoxy)ethyl]-1,4-diazepan-5-one (PubChem CID 24733010) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 4-benzyl-1-[2-(4-chlorophenoxy)ethyl]-1,4-diazepan-5-one.
| Compound Name | 4-benzyl-1-[2-(4-chlorophenoxy)ethyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 24733010 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4-benzyl-1-[2-(4-chlorophenoxy)ethyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(CCOc2ccc(Cl)cc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H23ClN2O2/c21-18-6-8-19(9-7-18)25-15-14-22-11-10-20(24)23(13-12-22)16-17-4-2-1-3-5-17/h1-9H,10-16H2 |
| InChIKey | TVVHFLYNDKTULK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |