C21H22ClN5O2 — CID 54455575
1-[(4-aminoquinazolin-7-yl)methyl]-4-[2-(4-chlorophenoxy)ethyl]piperazin-2-one (PubChem CID 54455575) has the molecular formula C21H22ClN5O2 and a molecular weight of 411.89 g/mol. Its IUPAC name is 1-[(4-aminoquinazolin-7-yl)methyl]-4-[2-(4-chlorophenoxy)ethyl]piperazin-2-one.
| Compound Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[2-(4-chlorophenoxy)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 54455575 |
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[2-(4-chlorophenoxy)ethyl]piperazin-2-one |
| SMILES | Nc1ncnc2cc(CN3CCN(CCOc4ccc(Cl)cc4)CC3=O)ccc12 |
| InChI | InChI=1S/C21H22ClN5O2/c22-16-2-4-17(5-3-16)29-10-9-26-7-8-27(20(28)13-26)12-15-1-6-18-19(11-15)24-14-25-21(18)23/h1-6,11,14H,7-10,12-13H2,(H2,23,24,25) |
| InChIKey | WXYQDCFUOLKYFG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |