C22H22ClN5 — CID 174415094
7-[[4-[3-(4-chlorophenyl)prop-2-ynyl]piperazin-1-yl]methyl]quinazolin-4-amine (PubChem CID 174415094) has the molecular formula C22H22ClN5 and a molecular weight of 391.91 g/mol. Its IUPAC name is 7-[[4-[3-(4-chlorophenyl)prop-2-ynyl]piperazin-1-yl]methyl]quinazolin-4-amine.
| Compound Name | 7-[[4-[3-(4-chlorophenyl)prop-2-ynyl]piperazin-1-yl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 174415094 |
| Molecular Formula | C22H22ClN5 |
| Molecular Weight | 391.91 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 7-[[4-[3-(4-chlorophenyl)prop-2-ynyl]piperazin-1-yl]methyl]quinazolin-4-amine |
| SMILES | Nc1ncnc2cc(CN3CCN(CC#Cc4ccc(Cl)cc4)CC3)ccc12 |
| InChI | InChI=1S/C22H22ClN5/c23-19-6-3-17(4-7-19)2-1-9-27-10-12-28(13-11-27)15-18-5-8-20-21(14-18)25-16-26-22(20)24/h3-8,14,16H,9-13,15H2,(H2,24,25,26) |
| InChIKey | QVBDHJVVKOIAQK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.91 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|