C25H24ClN5OS — CID 174447629
1-[(4-aminoquinazolin-7-yl)methyl]-4-[[5-(4-chlorophenyl)thiophen-2-yl]methyl]piperazine-2-carbaldehyde (PubChem CID 174447629) has the molecular formula C25H24ClN5OS and a molecular weight of 478.02 g/mol. Its IUPAC name is 1-[(4-aminoquinazolin-7-yl)methyl]-4-[[5-(4-chlorophenyl)thiophen-2-yl]methyl]piperazine-2-carbaldehyde.
| Compound Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[[5-(4-chlorophenyl)thiophen-2-yl]methyl]piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174447629 |
| Molecular Formula | C25H24ClN5OS |
| Molecular Weight | 478.02 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[[5-(4-chlorophenyl)thiophen-2-yl]methyl]piperazine-2-carbaldehyde |
| SMILES | Nc1ncnc2cc(CN3CCN(Cc4ccc(-c5ccc(Cl)cc5)s4)CC3C=O)ccc12 |
| InChI | InChI=1S/C25H24ClN5OS/c26-19-4-2-18(3-5-19)24-8-6-21(33-24)14-30-9-10-31(20(13-30)15-32)12-17-1-7-22-23(11-17)28-16-29-25(22)27/h1-8,11,15-16,20H,9-10,12-14H2,(H2,27,28,29) |
| InChIKey | APCBLYDEHJNVTA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.02 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|