C22H20ClN5O3S2 — CID 174415010
1-[(4-aminoquinazolin-6-yl)methyl]-4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]piperazine-2-carbaldehyde (PubChem CID 174415010) has the molecular formula C22H20ClN5O3S2 and a molecular weight of 502.02 g/mol. Its IUPAC name is 1-[(4-aminoquinazolin-6-yl)methyl]-4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]piperazine-2-carbaldehyde.
| Compound Name | 1-[(4-aminoquinazolin-6-yl)methyl]-4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174415010 |
| Molecular Formula | C22H20ClN5O3S2 |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 1-[(4-aminoquinazolin-6-yl)methyl]-4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]piperazine-2-carbaldehyde |
| SMILES | Nc1ncnc2ccc(CN3CCN(S(=O)(=O)c4cc5ccc(Cl)cc5s4)CC3C=O)cc12 |
| InChI | InChI=1S/C22H20ClN5O3S2/c23-16-3-2-15-8-21(32-20(15)9-16)33(30,31)28-6-5-27(17(11-28)12-29)10-14-1-4-19-18(7-14)22(24)26-13-25-19/h1-4,7-9,12-13,17H,5-6,10-11H2,(H2,24,25,26) |
| InChIKey | ZTIODLMDCBOWOM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|