C24H25N5OS — CID 175240582
1-[(4-aminoquinazolin-7-yl)methyl]-4-[(5-methyl-1-benzothiophen-2-yl)methyl]piperazine-2-carbaldehyde (PubChem CID 175240582) has the molecular formula C24H25N5OS and a molecular weight of 431.57 g/mol. Its IUPAC name is 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(5-methyl-1-benzothiophen-2-yl)methyl]piperazine-2-carbaldehyde.
| Compound Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(5-methyl-1-benzothiophen-2-yl)methyl]piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 175240582 |
| Molecular Formula | C24H25N5OS |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(5-methyl-1-benzothiophen-2-yl)methyl]piperazine-2-carbaldehyde |
| SMILES | Cc1ccc2sc(CN3CCN(Cc4ccc5c(N)ncnc5c4)C(C=O)C3)cc2c1 |
| InChI | InChI=1S/C24H25N5OS/c1-16-2-5-23-18(8-16)10-20(31-23)13-28-6-7-29(19(12-28)14-30)11-17-3-4-21-22(9-17)26-15-27-24(21)25/h2-5,8-10,14-15,19H,6-7,11-13H2,1H3,(H2,25,26,27) |
| InChIKey | UIHNQPZKFNJMDM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|