C23H22ClN5OS — CID 174450223
1-[(4-aminoquinazolin-7-yl)methyl]-4-[(5-chloro-1-benzothiophen-2-yl)methyl]piperazine-2-carbaldehyde (PubChem CID 174450223) has the molecular formula C23H22ClN5OS and a molecular weight of 451.98 g/mol. Its IUPAC name is 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(5-chloro-1-benzothiophen-2-yl)methyl]piperazine-2-carbaldehyde.
| Compound Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(5-chloro-1-benzothiophen-2-yl)methyl]piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174450223 |
| Molecular Formula | C23H22ClN5OS |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(5-chloro-1-benzothiophen-2-yl)methyl]piperazine-2-carbaldehyde |
| SMILES | Nc1ncnc2cc(CN3CCN(Cc4cc5cc(Cl)ccc5s4)CC3C=O)ccc12 |
| InChI | InChI=1S/C23H22ClN5OS/c24-17-2-4-22-16(8-17)9-19(31-22)12-28-5-6-29(18(11-28)13-30)10-15-1-3-20-21(7-15)26-14-27-23(20)25/h1-4,7-9,13-14,18H,5-6,10-12H2,(H2,25,26,27) |
| InChIKey | IXSZMPKYQKHSRT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|