C23H21ClN6O2 — CID 174447527
1-[(4-aminoquinazolin-7-yl)methyl]-4-(3-chloro-1H-indole-6-carbonyl)piperazine-2-carbaldehyde (PubChem CID 174447527) has the molecular formula C23H21ClN6O2 and a molecular weight of 448.91 g/mol. Its IUPAC name is 1-[(4-aminoquinazolin-7-yl)methyl]-4-(3-chloro-1H-indole-6-carbonyl)piperazine-2-carbaldehyde.
| Compound Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-(3-chloro-1H-indole-6-carbonyl)piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174447527 |
| Molecular Formula | C23H21ClN6O2 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-(3-chloro-1H-indole-6-carbonyl)piperazine-2-carbaldehyde |
| SMILES | Nc1ncnc2cc(CN3CCN(C(=O)c4ccc5c(Cl)c[nH]c5c4)CC3C=O)ccc12 |
| InChI | InChI=1S/C23H21ClN6O2/c24-19-9-26-21-8-15(2-4-17(19)21)23(32)30-6-5-29(16(11-30)12-31)10-14-1-3-18-20(7-14)27-13-28-22(18)25/h1-4,7-9,12-13,16,26H,5-6,10-11H2,(H2,25,27,28) |
| InChIKey | LRDAQBSGURLWFT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|