C23H26ClN5O2S — CID 174452082
(3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)propanoyl]-3-ethylpiperazine-2-carbaldehyde (PubChem CID 174452082) has the molecular formula C23H26ClN5O2S and a molecular weight of 472.01 g/mol. Its IUPAC name is (3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)propanoyl]-3-ethylpiperazine-2-carbaldehyde.
| Compound Name | (3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)propanoyl]-3-ethylpiperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174452082 |
| Molecular Formula | C23H26ClN5O2S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | (3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)propanoyl]-3-ethylpiperazine-2-carbaldehyde |
| SMILES | CC[C@H]1C(C=O)N(Cc2ccc3c(N)ncnc3c2)CCN1C(=O)CCc1ccc(Cl)s1 |
| InChI | InChI=1S/C23H26ClN5O2S/c1-2-19-20(13-30)28(12-15-3-6-17-18(11-15)26-14-27-23(17)25)9-10-29(19)22(31)8-5-16-4-7-21(24)32-16/h3-4,6-7,11,13-14,19-20H,2,5,8-10,12H2,1H3,(H2,25,26,27)/t19-,20?/m0/s1 |
| InChIKey | KABHLOINERDICG-XJDOXCRVSA-N |
| XLogP | 3.55 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|