C22H22BrN5O2S — CID 174461051
(3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(4-bromothiophen-2-yl)prop-2-enoyl]-3-methylpiperazine-2-carbaldehyde (PubChem CID 174461051) has the molecular formula C22H22BrN5O2S and a molecular weight of 500.42 g/mol. Its IUPAC name is (3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(4-bromothiophen-2-yl)prop-2-enoyl]-3-methylpiperazine-2-carbaldehyde.
| Compound Name | (3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(4-bromothiophen-2-yl)prop-2-enoyl]-3-methylpiperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174461051 |
| Molecular Formula | C22H22BrN5O2S |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | (3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(4-bromothiophen-2-yl)prop-2-enoyl]-3-methylpiperazine-2-carbaldehyde |
| SMILES | C[C@H]1C(C=O)N(Cc2ccc3c(N)ncnc3c2)CCN1C(=O)C=Cc1cc(Br)cs1 |
| InChI | InChI=1S/C22H22BrN5O2S/c1-14-20(11-29)27(10-15-2-4-18-19(8-15)25-13-26-22(18)24)6-7-28(14)21(30)5-3-17-9-16(23)12-31-17/h2-5,8-9,11-14,20H,6-7,10H2,1H3,(H2,24,25,26)/t14-,20?/m0/s1 |
| InChIKey | NKHAKVPSWCIHMK-PVCZSOGJSA-N |
| XLogP | 3.35 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|