C22H22ClN5O3S — CID 69024939
1-[(4-aminoquinazolin-7-yl)methyl]-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-(methoxymethyl)piperazin-2-one (PubChem CID 69024939) has the molecular formula C22H22ClN5O3S and a molecular weight of 471.97 g/mol. Its IUPAC name is 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-(methoxymethyl)piperazin-2-one.
| Compound Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-(methoxymethyl)piperazin-2-one |
|---|---|
| PubChem CID | 69024939 |
| Molecular Formula | C22H22ClN5O3S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-(methoxymethyl)piperazin-2-one |
| SMILES | COCC1C(=O)N(Cc2ccc3c(N)ncnc3c2)CCN1C(=O)/C=C/c1ccc(Cl)s1 |
| InChI | InChI=1S/C22H22ClN5O3S/c1-31-12-18-22(30)27(11-14-2-5-16-17(10-14)25-13-26-21(16)24)8-9-28(18)20(29)7-4-15-3-6-19(23)32-15/h2-7,10,13,18H,8-9,11-12H2,1H3,(H2,24,25,26)/b7-4+ |
| InChIKey | JLEJMDXRGFSELX-QPJJXVBHSA-N |
| XLogP | 2.83 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|