C24H24ClN5O3 — CID 54008677
(3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(4-chlorophenyl)prop-2-enoyl]-3-(methoxymethyl)piperazin-2-one (PubChem CID 54008677) has the molecular formula C24H24ClN5O3 and a molecular weight of 465.94 g/mol. Its IUPAC name is (3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(4-chlorophenyl)prop-2-enoyl]-3-(methoxymethyl)piperazin-2-one.
| Compound Name | (3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(4-chlorophenyl)prop-2-enoyl]-3-(methoxymethyl)piperazin-2-one |
|---|---|
| PubChem CID | 54008677 |
| Molecular Formula | C24H24ClN5O3 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(4-chlorophenyl)prop-2-enoyl]-3-(methoxymethyl)piperazin-2-one |
| SMILES | COC[C@H]1C(=O)N(Cc2ccc3c(N)ncnc3c2)CCN1C(=O)C=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24ClN5O3/c1-33-14-21-24(32)29(13-17-4-8-19-20(12-17)27-15-28-23(19)26)10-11-30(21)22(31)9-5-16-2-6-18(25)7-3-16/h2-9,12,15,21H,10-11,13-14H2,1H3,(H2,26,27,28)/t21-/m0/s1 |
| InChIKey | KQSVXMPQUMBFSM-NRFANRHFSA-N |
| XLogP | 2.76 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|