C21H20ClN5O3S — CID 67014427
(3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-(hydroxymethyl)piperazin-2-one (PubChem CID 67014427) has the molecular formula C21H20ClN5O3S and a molecular weight of 457.94 g/mol. Its IUPAC name is (3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-(hydroxymethyl)piperazin-2-one.
| Compound Name | (3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-(hydroxymethyl)piperazin-2-one |
|---|---|
| PubChem CID | 67014427 |
| Molecular Formula | C21H20ClN5O3S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | (3S)-1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-(hydroxymethyl)piperazin-2-one |
| SMILES | Nc1ncnc2cc(CN3CCN(C(=O)C=Cc4ccc(Cl)s4)[C@@H](CO)C3=O)ccc12 |
| InChI | InChI=1S/C21H20ClN5O3S/c22-18-5-2-14(31-18)3-6-19(29)27-8-7-26(21(30)17(27)11-28)10-13-1-4-15-16(9-13)24-12-25-20(15)23/h1-6,9,12,17,28H,7-8,10-11H2,(H2,23,24,25)/t17-/m0/s1 |
| InChIKey | LBIUTUCBLSATKR-KRWDZBQOSA-N |
| XLogP | 2.17 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|