C28H29ClN4O — CID 174447621
1-[(4-aminoquinolin-7-yl)methyl]-4-[(6-chloronaphthalen-2-yl)methyl]-3-ethylpiperazine-2-carbaldehyde (PubChem CID 174447621) has the molecular formula C28H29ClN4O and a molecular weight of 473.02 g/mol. Its IUPAC name is 1-[(4-aminoquinolin-7-yl)methyl]-4-[(6-chloronaphthalen-2-yl)methyl]-3-ethylpiperazine-2-carbaldehyde.
| Compound Name | 1-[(4-aminoquinolin-7-yl)methyl]-4-[(6-chloronaphthalen-2-yl)methyl]-3-ethylpiperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174447621 |
| Molecular Formula | C28H29ClN4O |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 1-[(4-aminoquinolin-7-yl)methyl]-4-[(6-chloronaphthalen-2-yl)methyl]-3-ethylpiperazine-2-carbaldehyde |
| SMILES | CCC1C(C=O)N(Cc2ccc3c(N)ccnc3c2)CCN1Cc1ccc2cc(Cl)ccc2c1 |
| InChI | InChI=1S/C28H29ClN4O/c1-2-27-28(18-34)33(17-20-4-8-24-25(30)9-10-31-26(24)14-20)12-11-32(27)16-19-3-5-22-15-23(29)7-6-21(22)13-19/h3-10,13-15,18,27-28H,2,11-12,16-17H2,1H3,(H2,30,31) |
| InChIKey | WQVBUEAXJOSSNP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|