C26H26Cl2N4O2 — CID 175240594
4-[(5-chloro-1H-indol-2-yl)methyl]-1-[(4-chloroquinolin-7-yl)methyl]-3-(methoxymethyl)piperazine-2-carbaldehyde (PubChem CID 175240594) has the molecular formula C26H26Cl2N4O2 and a molecular weight of 497.43 g/mol. Its IUPAC name is 4-[(5-chloro-1H-indol-2-yl)methyl]-1-[(4-chloroquinolin-7-yl)methyl]-3-(methoxymethyl)piperazine-2-carbaldehyde.
| Compound Name | 4-[(5-chloro-1H-indol-2-yl)methyl]-1-[(4-chloroquinolin-7-yl)methyl]-3-(methoxymethyl)piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 175240594 |
| Molecular Formula | C26H26Cl2N4O2 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 4-[(5-chloro-1H-indol-2-yl)methyl]-1-[(4-chloroquinolin-7-yl)methyl]-3-(methoxymethyl)piperazine-2-carbaldehyde |
| SMILES | COCC1C(C=O)N(Cc2ccc3c(Cl)ccnc3c2)CCN1Cc1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C26H26Cl2N4O2/c1-34-16-26-25(15-33)31(13-17-2-4-21-22(28)6-7-29-24(21)10-17)8-9-32(26)14-20-12-18-11-19(27)3-5-23(18)30-20/h2-7,10-12,15,25-26,30H,8-9,13-14,16H2,1H3 |
| InChIKey | PUNKXWCNSUYTJY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|